C26H35Cl2NO3 — CID 101164913
2-(2,4-ditert-butylphenoxy)-N-(3,5-dichloro-4-ethyl-2-hydroxyphenyl)butanamide (PubChem CID 101164913) has the molecular formula C26H35Cl2NO3 and a molecular weight of 480.48 g/mol. Its IUPAC name is 2-(2,4-ditert-butylphenoxy)-N-(3,5-dichloro-4-ethyl-2-hydroxyphenyl)butanamide.
| Compound Name | 2-(2,4-ditert-butylphenoxy)-N-(3,5-dichloro-4-ethyl-2-hydroxyphenyl)butanamide |
|---|---|
| PubChem CID | 101164913 |
| Molecular Formula | C26H35Cl2NO3 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 2-(2,4-ditert-butylphenoxy)-N-(3,5-dichloro-4-ethyl-2-hydroxyphenyl)butanamide |
| SMILES | CCc1c(Cl)cc(NC(=O)C(CC)Oc2ccc(C(C)(C)C)cc2C(C)(C)C)c(O)c1Cl |
| InChI | InChI=1S/C26H35Cl2NO3/c1-9-16-18(27)14-19(23(30)22(16)28)29-24(31)20(10-2)32-21-12-11-15(25(3,4)5)13-17(21)26(6,7)8/h11-14,20,30H,9-10H2,1-8H3,(H,29,31) |
| InChIKey | AOWLHSONHKKUGM-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|