C22H27Cl2NO3 — CID 19391879
N-(3,5-dichloro-4-ethyl-2-hydroxyphenyl)-2-[4-methyl-2-(2-methylbutan-2-yl)phenoxy]acetamide (PubChem CID 19391879) has the molecular formula C22H27Cl2NO3 and a molecular weight of 424.37 g/mol. Its IUPAC name is N-(3,5-dichloro-4-ethyl-2-hydroxyphenyl)-2-[4-methyl-2-(2-methylbutan-2-yl)phenoxy]acetamide.
| Compound Name | N-(3,5-dichloro-4-ethyl-2-hydroxyphenyl)-2-[4-methyl-2-(2-methylbutan-2-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 19391879 |
| Molecular Formula | C22H27Cl2NO3 |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | N-(3,5-dichloro-4-ethyl-2-hydroxyphenyl)-2-[4-methyl-2-(2-methylbutan-2-yl)phenoxy]acetamide |
| SMILES | CCc1c(Cl)cc(NC(=O)COc2ccc(C)cc2C(C)(C)CC)c(O)c1Cl |
| InChI | InChI=1S/C22H27Cl2NO3/c1-6-14-16(23)11-17(21(27)20(14)24)25-19(26)12-28-18-9-8-13(3)10-15(18)22(4,5)7-2/h8-11,27H,6-7,12H2,1-5H3,(H,25,26) |
| InChIKey | XBQFSILFWGWINK-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|