C20H23NO5 — CID 108766535
4-[[2-(2-tert-butyl-4-methylphenoxy)acetyl]amino]-3-hydroxybenzoic acid (PubChem CID 108766535) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-[[2-(2-tert-butyl-4-methylphenoxy)acetyl]amino]-3-hydroxybenzoic acid.
| Compound Name | 4-[[2-(2-tert-butyl-4-methylphenoxy)acetyl]amino]-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 108766535 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 4-[[2-(2-tert-butyl-4-methylphenoxy)acetyl]amino]-3-hydroxybenzoic acid |
| SMILES | Cc1ccc(OCC(=O)Nc2ccc(C(=O)O)cc2O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H23NO5/c1-12-5-8-17(14(9-12)20(2,3)4)26-11-18(23)21-15-7-6-13(19(24)25)10-16(15)22/h5-10,22H,11H2,1-4H3,(H,21,23)(H,24,25) |
| InChIKey | RWGRCDJBYPPWGL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|