C22H28N2O5 — CID 108541208
N-[2-[[2-(2-tert-butyl-4-methylphenoxy)acetyl]amino]ethyl]-3,5-dihydroxybenzamide (PubChem CID 108541208) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-[2-[[2-(2-tert-butyl-4-methylphenoxy)acetyl]amino]ethyl]-3,5-dihydroxybenzamide.
| Compound Name | N-[2-[[2-(2-tert-butyl-4-methylphenoxy)acetyl]amino]ethyl]-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 108541208 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | N-[2-[[2-(2-tert-butyl-4-methylphenoxy)acetyl]amino]ethyl]-3,5-dihydroxybenzamide |
| SMILES | Cc1ccc(OCC(=O)NCCNC(=O)c2cc(O)cc(O)c2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H28N2O5/c1-14-5-6-19(18(9-14)22(2,3)4)29-13-20(27)23-7-8-24-21(28)15-10-16(25)12-17(26)11-15/h5-6,9-12,25-26H,7-8,13H2,1-4H3,(H,23,27)(H,24,28) |
| InChIKey | UXXILFBOACXWIJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|