C22H25F3N2O3 — CID 108541196
N-[2-[[2-(2-tert-butyl-4-methylphenoxy)acetyl]amino]ethyl]-2,3,4-trifluorobenzamide (PubChem CID 108541196) has the molecular formula C22H25F3N2O3 and a molecular weight of 422.45 g/mol. Its IUPAC name is N-[2-[[2-(2-tert-butyl-4-methylphenoxy)acetyl]amino]ethyl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[2-[[2-(2-tert-butyl-4-methylphenoxy)acetyl]amino]ethyl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 108541196 |
| Molecular Formula | C22H25F3N2O3 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | N-[2-[[2-(2-tert-butyl-4-methylphenoxy)acetyl]amino]ethyl]-2,3,4-trifluorobenzamide |
| SMILES | Cc1ccc(OCC(=O)NCCNC(=O)c2ccc(F)c(F)c2F)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H25F3N2O3/c1-13-5-8-17(15(11-13)22(2,3)4)30-12-18(28)26-9-10-27-21(29)14-6-7-16(23)20(25)19(14)24/h5-8,11H,9-10,12H2,1-4H3,(H,26,28)(H,27,29) |
| InChIKey | OCHWSVWPFSMKQN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|