C19H21ClN2O5 — CID 108541263
N-[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethyl]-3,5-dihydroxybenzamide (PubChem CID 108541263) has the molecular formula C19H21ClN2O5 and a molecular weight of 392.84 g/mol. Its IUPAC name is N-[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethyl]-3,5-dihydroxybenzamide.
| Compound Name | N-[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethyl]-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 108541263 |
| Molecular Formula | C19H21ClN2O5 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | N-[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethyl]-3,5-dihydroxybenzamide |
| SMILES | Cc1cc(OCC(=O)NCCNC(=O)c2cc(O)cc(O)c2)cc(C)c1Cl |
| InChI | InChI=1S/C19H21ClN2O5/c1-11-5-16(6-12(2)18(11)20)27-10-17(25)21-3-4-22-19(26)13-7-14(23)9-15(24)8-13/h5-9,23-24H,3-4,10H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | GTMCMVGEIWYLEU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|