C25H35NO2 — CID 3587302
2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 3587302) has the molecular formula C25H35NO2 and a molecular weight of 381.56 g/mol. Its IUPAC name is 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 3587302 |
| Molecular Formula | C25H35NO2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | CCC(C)(C)c1ccc(OCC(=O)Nc2ccccc2C)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C25H35NO2/c1-8-24(4,5)19-14-15-22(20(16-19)25(6,7)9-2)28-17-23(27)26-21-13-11-10-12-18(21)3/h10-16H,8-9,17H2,1-7H3,(H,26,27) |
| InChIKey | PJCKZTBIZZKRGH-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |