C29H42N2O2 — CID 4164895
2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 4164895) has the molecular formula C29H42N2O2 and a molecular weight of 450.67 g/mol. Its IUPAC name is 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 4164895 |
| Molecular Formula | C29H42N2O2 |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | CCC(C)(C)c1ccc(OCC(=O)Nc2ccc(N3CCCCC3)cc2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C29H42N2O2/c1-7-28(3,4)22-12-17-26(25(20-22)29(5,6)8-2)33-21-27(32)30-23-13-15-24(16-14-23)31-18-10-9-11-19-31/h12-17,20H,7-11,18-19,21H2,1-6H3,(H,30,32) |
| InChIKey | WWWGFZBBVCXASM-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|