C23H29BrN2O2 — CID 100513139
2-(2-bromo-4-tert-butylphenoxy)-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 100513139) has the molecular formula C23H29BrN2O2 and a molecular weight of 445.40 g/mol. Its IUPAC name is 2-(2-bromo-4-tert-butylphenoxy)-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-(2-bromo-4-tert-butylphenoxy)-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 100513139 |
| Molecular Formula | C23H29BrN2O2 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 2-(2-bromo-4-tert-butylphenoxy)-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)Nc2ccc(N3CCCCC3)cc2)c(Br)c1 |
| InChI | InChI=1S/C23H29BrN2O2/c1-23(2,3)17-7-12-21(20(24)15-17)28-16-22(27)25-18-8-10-19(11-9-18)26-13-5-4-6-14-26/h7-12,15H,4-6,13-14,16H2,1-3H3,(H,25,27) |
| InChIKey | OQRDHURLWWZAGM-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|