C21H24N2O4 — CID 26654844
2-(4-formyl-2-methoxyphenoxy)-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 26654844) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is 2-(4-formyl-2-methoxyphenoxy)-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-(4-formyl-2-methoxyphenoxy)-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 26654844 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 2-(4-formyl-2-methoxyphenoxy)-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | COc1cc(C=O)ccc1OCC(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H24N2O4/c1-26-20-13-16(14-24)5-10-19(20)27-15-21(25)22-17-6-8-18(9-7-17)23-11-3-2-4-12-23/h5-10,13-14H,2-4,11-12,15H2,1H3,(H,22,25) |
| InChIKey | KMYBZJZBJOXICQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|