C35H44N2O4 — CID 3911356
3-[4-[[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetyl]amino]phenyl]-N-(3,5-dimethylphenyl)-3-oxopropanamide (PubChem CID 3911356) has the molecular formula C35H44N2O4 and a molecular weight of 556.75 g/mol. Its IUPAC name is 3-[4-[[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetyl]amino]phenyl]-N-(3,5-dimethylphenyl)-3-oxopropanamide.
| Compound Name | 3-[4-[[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetyl]amino]phenyl]-N-(3,5-dimethylphenyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 3911356 |
| Molecular Formula | C35H44N2O4 |
| Molecular Weight | 556.75 g/mol |
| Exact Mass | 556.33 |
| IUPAC Name | 3-[4-[[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetyl]amino]phenyl]-N-(3,5-dimethylphenyl)-3-oxopropanamide |
| SMILES | CCC(C)(C)c1ccc(OCC(=O)Nc2ccc(C(=O)CC(=O)Nc3cc(C)cc(C)c3)cc2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C35H44N2O4/c1-9-34(5,6)26-13-16-31(29(20-26)35(7,8)10-2)41-22-33(40)36-27-14-11-25(12-15-27)30(38)21-32(39)37-28-18-23(3)17-24(4)19-28/h11-20H,9-10,21-22H2,1-8H3,(H,36,40)(H,37,39) |
| InChIKey | GTAHNPRGPFSJNF-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.75 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|