C23H26ClNO5S — CID 59899958
(E)-3-[3-chloro-5-[2-(2,4-dimethylphenoxy)butanoylamino]-2-ethyl-4-hydroxyphenyl]sulfanylprop-2-enoic acid (PubChem CID 59899958) has the molecular formula C23H26ClNO5S and a molecular weight of 463.98 g/mol. Its IUPAC name is (E)-3-[3-chloro-5-[2-(2,4-dimethylphenoxy)butanoylamino]-2-ethyl-4-hydroxyphenyl]sulfanylprop-2-enoic acid.
| Compound Name | (E)-3-[3-chloro-5-[2-(2,4-dimethylphenoxy)butanoylamino]-2-ethyl-4-hydroxyphenyl]sulfanylprop-2-enoic acid |
|---|---|
| PubChem CID | 59899958 |
| Molecular Formula | C23H26ClNO5S |
| Molecular Weight | 463.98 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | (E)-3-[3-chloro-5-[2-(2,4-dimethylphenoxy)butanoylamino]-2-ethyl-4-hydroxyphenyl]sulfanylprop-2-enoic acid |
| SMILES | CCc1c(S/C=C/C(=O)O)cc(NC(=O)C(CC)Oc2ccc(C)cc2C)c(O)c1Cl |
| InChI | InChI=1S/C23H26ClNO5S/c1-5-15-19(31-10-9-20(26)27)12-16(22(28)21(15)24)25-23(29)17(6-2)30-18-8-7-13(3)11-14(18)4/h7-12,17,28H,5-6H2,1-4H3,(H,25,29)(H,26,27)/b10-9+ |
| InChIKey | XVVLSUHXKCUHAK-MDZDMXLPSA-N |
| XLogP | 5.71 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.98 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|