C17H14Cl2F3NO2 — CID 94011805
(2R)-2-(2-chlorophenoxy)-N-[2-chloro-5-(trifluoromethyl)phenyl]butanamide (PubChem CID 94011805) has the molecular formula C17H14Cl2F3NO2 and a molecular weight of 392.20 g/mol. Its IUPAC name is (2R)-2-(2-chlorophenoxy)-N-[2-chloro-5-(trifluoromethyl)phenyl]butanamide.
| Compound Name | (2R)-2-(2-chlorophenoxy)-N-[2-chloro-5-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 94011805 |
| Molecular Formula | C17H14Cl2F3NO2 |
| Molecular Weight | 392.20 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | (2R)-2-(2-chlorophenoxy)-N-[2-chloro-5-(trifluoromethyl)phenyl]butanamide |
| SMILES | CC[C@@H](Oc1ccccc1Cl)C(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C17H14Cl2F3NO2/c1-2-14(25-15-6-4-3-5-12(15)19)16(24)23-13-9-10(17(20,21)22)7-8-11(13)18/h3-9,14H,2H2,1H3,(H,23,24)/t14-/m1/s1 |
| InChIKey | RDOHNYBADLDDQC-CQSZACIVSA-N |
| XLogP | 5.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.20 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |