C17H14ClF4NO2 — CID 46772392
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(4-fluorophenoxy)butanamide (PubChem CID 46772392) has the molecular formula C17H14ClF4NO2 and a molecular weight of 375.75 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(4-fluorophenoxy)butanamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(4-fluorophenoxy)butanamide |
|---|---|
| PubChem CID | 46772392 |
| Molecular Formula | C17H14ClF4NO2 |
| Molecular Weight | 375.75 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(4-fluorophenoxy)butanamide |
| SMILES | CCC(Oc1ccc(F)cc1)C(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C17H14ClF4NO2/c1-2-15(25-12-6-4-11(19)5-7-12)16(24)23-14-9-10(17(20,21)22)3-8-13(14)18/h3-9,15H,2H2,1H3,(H,23,24) |
| InChIKey | VSFKOWKDXVCIID-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.75 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |