C22H39ClO2 — CID 70357884
2-[2,4-bis(2-methylbutan-2-yl)phenoxy]hexan-1-ol;hydrochloride (PubChem CID 70357884) has the molecular formula C22H39ClO2 and a molecular weight of 371.01 g/mol. Its IUPAC name is 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]hexan-1-ol;hydrochloride.
| Compound Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]hexan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 70357884 |
| Molecular Formula | C22H39ClO2 |
| Molecular Weight | 371.01 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]hexan-1-ol;hydrochloride |
| SMILES | CCCCC(CO)Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC.Cl |
| InChI | InChI=1S/C22H38O2.ClH/c1-8-11-12-18(16-23)24-20-14-13-17(21(4,5)9-2)15-19(20)22(6,7)10-3;/h13-15,18,23H,8-12,16H2,1-7H3;1H |
| InChIKey | AFXKAFOPBAFGPA-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.01 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |