C37H58F6O10S2 — CID 158539541
1,3-dimethoxy-2-methyl-5-(2-methyloctan-2-yl)benzene;2,6-dimethoxy-4-(2-methyloctan-2-yl)phenol;trifluoromethylsulfonyl trifluoromethanesulfonate (PubChem CID 158539541) has the molecular formula C37H58F6O10S2 and a molecular weight of 840.98 g/mol. Its IUPAC name is 1,3-dimethoxy-2-methyl-5-(2-methyloctan-2-yl)benzene;2,6-dimethoxy-4-(2-methyloctan-2-yl)phenol;trifluoromethylsulfonyl trifluoromethanesulfonate.
| Compound Name | 1,3-dimethoxy-2-methyl-5-(2-methyloctan-2-yl)benzene;2,6-dimethoxy-4-(2-methyloctan-2-yl)phenol;trifluoromethylsulfonyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 158539541 |
| Molecular Formula | C37H58F6O10S2 |
| Molecular Weight | 840.98 g/mol |
| Exact Mass | 840.34 |
| IUPAC Name | 1,3-dimethoxy-2-methyl-5-(2-methyloctan-2-yl)benzene;2,6-dimethoxy-4-(2-methyloctan-2-yl)phenol;trifluoromethylsulfonyl trifluoromethanesulfonate |
| SMILES | CCCCCCC(C)(C)c1cc(OC)c(C)c(OC)c1.CCCCCCC(C)(C)c1cc(OC)c(O)c(OC)c1.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H30O2.C17H28O3.C2F6O5S2/c1-7-8-9-10-11-18(3,4)15-12-16(19-5)14(2)17(13-15)20-6;1-6-7-8-9-10-17(2,3)13-11-14(19-4)16(18)15(12-13)20-5;3-1(4,5)14(9,10)13-15(11,12)2(6,7)8/h12-13H,7-11H2,1-6H3;11-12,18H,6-10H2,1-5H3; |
| InChIKey | HOIRSJYVMAZPGT-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.98 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|