C24H35O3P — CID 155575581
3-[methoxy(methyl)phosphanyl]oxy-5-(2-methyloctan-2-yl)-2-(3-methylphenyl)phenol (PubChem CID 155575581) has the molecular formula C24H35O3P and a molecular weight of 402.52 g/mol. Its IUPAC name is 3-[methoxy(methyl)phosphanyl]oxy-5-(2-methyloctan-2-yl)-2-(3-methylphenyl)phenol.
| Compound Name | 3-[methoxy(methyl)phosphanyl]oxy-5-(2-methyloctan-2-yl)-2-(3-methylphenyl)phenol |
|---|---|
| PubChem CID | 155575581 |
| Molecular Formula | C24H35O3P |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 3-[methoxy(methyl)phosphanyl]oxy-5-(2-methyloctan-2-yl)-2-(3-methylphenyl)phenol |
| SMILES | CCCCCCC(C)(C)c1cc(O)c(-c2cccc(C)c2)c(OP(C)OC)c1 |
| InChI | InChI=1S/C24H35O3P/c1-7-8-9-10-14-24(3,4)20-16-21(25)23(19-13-11-12-18(2)15-19)22(17-20)27-28(6)26-5/h11-13,15-17,25H,7-10,14H2,1-6H3 |
| InChIKey | VUANNEODZFXRBR-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|