C31H39NO4 — CID 155461308
methyl N-[[3-hydroxy-5-(2-methyloctan-2-yl)-2-(3-methylphenyl)phenoxy]methyl]-N-phenylcarbamate (PubChem CID 155461308) has the molecular formula C31H39NO4 and a molecular weight of 489.66 g/mol. Its IUPAC name is methyl N-[[3-hydroxy-5-(2-methyloctan-2-yl)-2-(3-methylphenyl)phenoxy]methyl]-N-phenylcarbamate.
| Compound Name | methyl N-[[3-hydroxy-5-(2-methyloctan-2-yl)-2-(3-methylphenyl)phenoxy]methyl]-N-phenylcarbamate |
|---|---|
| PubChem CID | 155461308 |
| Molecular Formula | C31H39NO4 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | methyl N-[[3-hydroxy-5-(2-methyloctan-2-yl)-2-(3-methylphenyl)phenoxy]methyl]-N-phenylcarbamate |
| SMILES | CCCCCCC(C)(C)c1cc(O)c(-c2cccc(C)c2)c(OCN(C(=O)OC)c2ccccc2)c1 |
| InChI | InChI=1S/C31H39NO4/c1-6-7-8-12-18-31(3,4)25-20-27(33)29(24-15-13-14-23(2)19-24)28(21-25)36-22-32(30(34)35-5)26-16-10-9-11-17-26/h9-11,13-17,19-21,33H,6-8,12,18,22H2,1-5H3 |
| InChIKey | PLQFOAHXPLGSEH-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|