C24H33NO5 — CID 164930047
2-methoxyethyl N-[(3-hydroxy-4-methyl-5-pentyl-2-phenylphenoxy)methyl]-N-methylcarbamate (PubChem CID 164930047) has the molecular formula C24H33NO5 and a molecular weight of 415.53 g/mol. Its IUPAC name is 2-methoxyethyl N-[(3-hydroxy-4-methyl-5-pentyl-2-phenylphenoxy)methyl]-N-methylcarbamate.
| Compound Name | 2-methoxyethyl N-[(3-hydroxy-4-methyl-5-pentyl-2-phenylphenoxy)methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 164930047 |
| Molecular Formula | C24H33NO5 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 2-methoxyethyl N-[(3-hydroxy-4-methyl-5-pentyl-2-phenylphenoxy)methyl]-N-methylcarbamate |
| SMILES | CCCCCc1cc(OCN(C)C(=O)OCCOC)c(-c2ccccc2)c(O)c1C |
| InChI | InChI=1S/C24H33NO5/c1-5-6-8-13-20-16-21(30-17-25(3)24(27)29-15-14-28-4)22(23(26)18(20)2)19-11-9-7-10-12-19/h7,9-12,16,26H,5-6,8,13-15,17H2,1-4H3 |
| InChIKey | HZYHOIUNLFRHPX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|