C29H45O3P — CID 88767163
(4,5-dibutyl-2-nonyl-3-phenylphenyl) dihydrogen phosphite (PubChem CID 88767163) has the molecular formula C29H45O3P and a molecular weight of 472.65 g/mol. Its IUPAC name is (4,5-dibutyl-2-nonyl-3-phenylphenyl) dihydrogen phosphite.
| Compound Name | (4,5-dibutyl-2-nonyl-3-phenylphenyl) dihydrogen phosphite |
|---|---|
| PubChem CID | 88767163 |
| Molecular Formula | C29H45O3P |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.31 |
| IUPAC Name | (4,5-dibutyl-2-nonyl-3-phenylphenyl) dihydrogen phosphite |
| SMILES | CCCCCCCCCc1c(OP(O)O)cc(CCCC)c(CCCC)c1-c1ccccc1 |
| InChI | InChI=1S/C29H45O3P/c1-4-7-10-11-12-13-17-22-27-28(32-33(30)31)23-25(18-8-5-2)26(21-9-6-3)29(27)24-19-15-14-16-20-24/h14-16,19-20,23,30-31H,4-13,17-18,21-22H2,1-3H3 |
| InChIKey | JHMJKDGYQYIGMZ-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|