About diphenyl hydrogen phosphite;(2-nonylphenyl) dihydrogen phosphite
diphenyl hydrogen phosphite;(2-nonylphenyl) dihydrogen phosphite (PubChem CID 88805641) has the molecular formula C27H36O6P2
and a molecular weight of 518.53 g/mol. Its IUPAC name is diphenyl hydrogen phosphite;(2-nonylphenyl) dihydrogen phosphite.
Molecular Properties
| Compound Name | diphenyl hydrogen phosphite;(2-nonylphenyl) dihydrogen phosphite |
| PubChem CID | 88805641 |
| Molecular Formula | C27H36O6P2 |
| Molecular Weight | 518.53 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | diphenyl hydrogen phosphite;(2-nonylphenyl) dihydrogen phosphite |
| SMILES | CCCCCCCCCc1ccccc1OP(O)O.OP(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C15H25O3P.C12H11O3P/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)18-19(16)17;13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h9-10,12-13,16-17H,2-8,11H2,1H3;1-10,13H |
| InChIKey | SLYOEVCEOGNXGC-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 518.53 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenyl hydrogen phosphite;(2-nonylphenyl) dihydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl hydrogen phosphite;(2-nonylphenyl) dihydrogen phosphite?
The IUPAC name of diphenyl hydrogen phosphite;(2-nonylphenyl) dihydrogen phosphite (CID 88805641) is diphenyl hydrogen phosphite;(2-nonylphenyl) dihydrogen phosphite.
What is the SMILES notation for diphenyl hydrogen phosphite;(2-nonylphenyl) dihydrogen phosphite?
The canonical SMILES for diphenyl hydrogen phosphite;(2-nonylphenyl) dihydrogen phosphite is CCCCCCCCCc1ccccc1OP(O)O.OP(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of diphenyl hydrogen phosphite;(2-nonylphenyl) dihydrogen phosphite?
The InChIKey is SLYOEVCEOGNXGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25O3P.C12H11O3P/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)18-19(16)17;13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h9-10,12-13,16-17H,2-8,11H2,1H3;1-10,13H.
What are the key properties of diphenyl hydrogen phosphite;(2-nonylphenyl) dihydrogen phosphite?
diphenyl hydrogen phosphite;(2-nonylphenyl) dihydrogen phosphite has a molecular weight of 518.53 g/mol, XLogP of 7.93, 14 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl hydrogen phosphite;(2-nonylphenyl) dihydrogen phosphite is sourced from PubChem (CID 88805641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).