About dihydroxyphosphanyl (2-nonylphenyl) hydrogen phosphite
dihydroxyphosphanyl (2-nonylphenyl) hydrogen phosphite (PubChem CID 154111856) has the molecular formula C15H26O5P2
and a molecular weight of 348.32 g/mol. Its IUPAC name is dihydroxyphosphanyl (2-nonylphenyl) hydrogen phosphite.
Molecular Properties
| Compound Name | dihydroxyphosphanyl (2-nonylphenyl) hydrogen phosphite |
| PubChem CID | 154111856 |
| Molecular Formula | C15H26O5P2 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | dihydroxyphosphanyl (2-nonylphenyl) hydrogen phosphite |
| SMILES | CCCCCCCCCc1ccccc1OP(O)OP(O)O |
| InChI | InChI=1S/C15H26O5P2/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)19-22(18)20-21(16)17/h9-10,12-13,16-18H,2-8,11H2,1H3 |
| InChIKey | NGNXRHRXFGYUMW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxyphosphanyl (2-nonylphenyl) hydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxyphosphanyl (2-nonylphenyl) hydrogen phosphite?
The IUPAC name of dihydroxyphosphanyl (2-nonylphenyl) hydrogen phosphite (CID 154111856) is dihydroxyphosphanyl (2-nonylphenyl) hydrogen phosphite.
What is the SMILES notation for dihydroxyphosphanyl (2-nonylphenyl) hydrogen phosphite?
The canonical SMILES for dihydroxyphosphanyl (2-nonylphenyl) hydrogen phosphite is CCCCCCCCCc1ccccc1OP(O)OP(O)O.
What is the InChIKey of dihydroxyphosphanyl (2-nonylphenyl) hydrogen phosphite?
The InChIKey is NGNXRHRXFGYUMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O5P2/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)19-22(18)20-21(16)17/h9-10,12-13,16-18H,2-8,11H2,1H3.
What are the key properties of dihydroxyphosphanyl (2-nonylphenyl) hydrogen phosphite?
dihydroxyphosphanyl (2-nonylphenyl) hydrogen phosphite has a molecular weight of 348.32 g/mol, XLogP of 4.81, 12 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxyphosphanyl (2-nonylphenyl) hydrogen phosphite is sourced from PubChem (CID 154111856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).