C21H37O3P — CID 141324371
(2,3,4-tripentylphenyl) dihydrogen phosphite (PubChem CID 141324371) has the molecular formula C21H37O3P and a molecular weight of 368.50 g/mol. Its IUPAC name is (2,3,4-tripentylphenyl) dihydrogen phosphite.
| Compound Name | (2,3,4-tripentylphenyl) dihydrogen phosphite |
|---|---|
| PubChem CID | 141324371 |
| Molecular Formula | C21H37O3P |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | (2,3,4-tripentylphenyl) dihydrogen phosphite |
| SMILES | CCCCCc1ccc(OP(O)O)c(CCCCC)c1CCCCC |
| InChI | InChI=1S/C21H37O3P/c1-4-7-10-13-18-16-17-21(24-25(22)23)20(15-12-9-6-3)19(18)14-11-8-5-2/h16-17,22-23H,4-15H2,1-3H3 |
| InChIKey | ULPXBRQXYBSAAY-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|