C22H39O3P — CID 150612862
(2,5-ditert-butyl-4-octylphenyl) dihydrogen phosphite (PubChem CID 150612862) has the molecular formula C22H39O3P and a molecular weight of 382.53 g/mol. Its IUPAC name is (2,5-ditert-butyl-4-octylphenyl) dihydrogen phosphite.
| Compound Name | (2,5-ditert-butyl-4-octylphenyl) dihydrogen phosphite |
|---|---|
| PubChem CID | 150612862 |
| Molecular Formula | C22H39O3P |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | (2,5-ditert-butyl-4-octylphenyl) dihydrogen phosphite |
| SMILES | CCCCCCCCc1cc(C(C)(C)C)c(OP(O)O)cc1C(C)(C)C |
| InChI | InChI=1S/C22H39O3P/c1-8-9-10-11-12-13-14-17-15-19(22(5,6)7)20(25-26(23)24)16-18(17)21(2,3)4/h15-16,23-24H,8-14H2,1-7H3 |
| InChIKey | BSBKVXMOFQJXKL-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|