C38H63O3P — CID 66926002
bis[2-tert-butyl-5-methyl-4-(2-methylheptan-2-yl)phenyl] hydrogen phosphite (PubChem CID 66926002) has the molecular formula C38H63O3P and a molecular weight of 598.89 g/mol. Its IUPAC name is bis[2-tert-butyl-5-methyl-4-(2-methylheptan-2-yl)phenyl] hydrogen phosphite.
| Compound Name | bis[2-tert-butyl-5-methyl-4-(2-methylheptan-2-yl)phenyl] hydrogen phosphite |
|---|---|
| PubChem CID | 66926002 |
| Molecular Formula | C38H63O3P |
| Molecular Weight | 598.89 g/mol |
| Exact Mass | 598.45 |
| IUPAC Name | bis[2-tert-butyl-5-methyl-4-(2-methylheptan-2-yl)phenyl] hydrogen phosphite |
| SMILES | CCCCCC(C)(C)c1cc(C(C)(C)C)c(OP(O)Oc2cc(C)c(C(C)(C)CCCCC)cc2C(C)(C)C)cc1C |
| InChI | InChI=1S/C38H63O3P/c1-15-17-19-21-37(11,12)29-25-31(35(5,6)7)33(23-27(29)3)40-42(39)41-34-24-28(4)30(26-32(34)36(8,9)10)38(13,14)22-20-18-16-2/h23-26,39H,15-22H2,1-14H3 |
| InChIKey | VSTAQFWCJPAUJC-UHFFFAOYSA-N |
| XLogP | 12.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.89 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|