C33H45O6P — CID 175167608
tris(2-tert-butyl-4-hydroxy-5-methylphenyl) phosphite (PubChem CID 175167608) has the molecular formula C33H45O6P and a molecular weight of 568.69 g/mol. Its IUPAC name is tris(2-tert-butyl-4-hydroxy-5-methylphenyl) phosphite.
| Compound Name | tris(2-tert-butyl-4-hydroxy-5-methylphenyl) phosphite |
|---|---|
| PubChem CID | 175167608 |
| Molecular Formula | C33H45O6P |
| Molecular Weight | 568.69 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | tris(2-tert-butyl-4-hydroxy-5-methylphenyl) phosphite |
| SMILES | Cc1cc(OP(Oc2cc(C)c(O)cc2C(C)(C)C)Oc2cc(C)c(O)cc2C(C)(C)C)c(C(C)(C)C)cc1O |
| InChI | InChI=1S/C33H45O6P/c1-19-13-28(22(16-25(19)34)31(4,5)6)37-40(38-29-14-20(2)26(35)17-23(29)32(7,8)9)39-30-15-21(3)27(36)18-24(30)33(10,11)12/h13-18,34-36H,1-12H3 |
| InChIKey | NEEWWGZAULKCSB-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.69 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|