About bis(3-tert-butyl-4-hydroxy-5-methylphenyl) ethyl phosphite
bis(3-tert-butyl-4-hydroxy-5-methylphenyl) ethyl phosphite (PubChem CID 59005147) has the molecular formula C24H35O5P
and a molecular weight of 434.51 g/mol. Its IUPAC name is bis(3-tert-butyl-4-hydroxy-5-methylphenyl) ethyl phosphite.
Molecular Properties
| Compound Name | bis(3-tert-butyl-4-hydroxy-5-methylphenyl) ethyl phosphite |
| PubChem CID | 59005147 |
| Molecular Formula | C24H35O5P |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | bis(3-tert-butyl-4-hydroxy-5-methylphenyl) ethyl phosphite |
| SMILES | CCOP(Oc1cc(C)c(O)c(C(C)(C)C)c1)Oc1cc(C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H35O5P/c1-10-27-30(28-17-11-15(2)21(25)19(13-17)23(4,5)6)29-18-12-16(3)22(26)20(14-18)24(7,8)9/h11-14,25-26H,10H2,1-9H3 |
| InChIKey | DKJUHZWXMXURCP-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(3-tert-butyl-4-hydroxy-5-methylphenyl) ethyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-tert-butyl-4-hydroxy-5-methylphenyl) ethyl phosphite?
The IUPAC name of bis(3-tert-butyl-4-hydroxy-5-methylphenyl) ethyl phosphite (CID 59005147) is bis(3-tert-butyl-4-hydroxy-5-methylphenyl) ethyl phosphite.
What is the SMILES notation for bis(3-tert-butyl-4-hydroxy-5-methylphenyl) ethyl phosphite?
The canonical SMILES for bis(3-tert-butyl-4-hydroxy-5-methylphenyl) ethyl phosphite is CCOP(Oc1cc(C)c(O)c(C(C)(C)C)c1)Oc1cc(C)c(O)c(C(C)(C)C)c1.
What is the InChIKey of bis(3-tert-butyl-4-hydroxy-5-methylphenyl) ethyl phosphite?
The InChIKey is DKJUHZWXMXURCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H35O5P/c1-10-27-30(28-17-11-15(2)21(25)19(13-17)23(4,5)6)29-18-12-16(3)22(26)20(14-18)24(7,8)9/h11-14,25-26H,10H2,1-9H3.
What are the key properties of bis(3-tert-butyl-4-hydroxy-5-methylphenyl) ethyl phosphite?
bis(3-tert-butyl-4-hydroxy-5-methylphenyl) ethyl phosphite has a molecular weight of 434.51 g/mol, XLogP of 7.03, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-tert-butyl-4-hydroxy-5-methylphenyl) ethyl phosphite is sourced from PubChem (CID 59005147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).