C15H25O4P — CID 2385006
2-tert-butyl-4-diethoxyphosphoryl-6-methylphenol (PubChem CID 2385006) has the molecular formula C15H25O4P and a molecular weight of 300.34 g/mol. Its IUPAC name is 2-tert-butyl-4-diethoxyphosphoryl-6-methylphenol.
| Compound Name | 2-tert-butyl-4-diethoxyphosphoryl-6-methylphenol |
|---|---|
| PubChem CID | 2385006 |
| Molecular Formula | C15H25O4P |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2-tert-butyl-4-diethoxyphosphoryl-6-methylphenol |
| SMILES | CCOP(=O)(OCC)c1cc(C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H25O4P/c1-7-18-20(17,19-8-2)12-9-11(3)14(16)13(10-12)15(4,5)6/h9-10,16H,7-8H2,1-6H3 |
| InChIKey | YCADMBLVASWXER-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|