C20H35O4P — CID 174446624
2,6-ditert-butyl-4-[2-[ethoxy(ethyl)phosphoryl]oxyethyl]phenol (PubChem CID 174446624) has the molecular formula C20H35O4P and a molecular weight of 370.47 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[2-[ethoxy(ethyl)phosphoryl]oxyethyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[2-[ethoxy(ethyl)phosphoryl]oxyethyl]phenol |
|---|---|
| PubChem CID | 174446624 |
| Molecular Formula | C20H35O4P |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 2,6-ditert-butyl-4-[2-[ethoxy(ethyl)phosphoryl]oxyethyl]phenol |
| SMILES | CCOP(=O)(CC)OCCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H35O4P/c1-9-23-25(22,10-2)24-12-11-15-13-16(19(3,4)5)18(21)17(14-15)20(6,7)8/h13-14,21H,9-12H2,1-8H3 |
| InChIKey | IQVHTFFJRBZXFZ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|