C37H65O8P2- — CID 158091243
2,6-ditert-butyl-4-(diethoxyphosphorylmethyl)phenol;(3,5-ditert-butyl-4-hydroxyphenyl)methyl-ethoxyphosphinate;methane (PubChem CID 158091243) has the molecular formula C37H65O8P2- and a molecular weight of 699.87 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(diethoxyphosphorylmethyl)phenol;(3,5-ditert-butyl-4-hydroxyphenyl)methyl-ethoxyphosphinate;methane.
| Compound Name | 2,6-ditert-butyl-4-(diethoxyphosphorylmethyl)phenol;(3,5-ditert-butyl-4-hydroxyphenyl)methyl-ethoxyphosphinate;methane |
|---|---|
| PubChem CID | 158091243 |
| Molecular Formula | C37H65O8P2- |
| Molecular Weight | 699.87 g/mol |
| Exact Mass | 699.42 |
| IUPAC Name | 2,6-ditert-butyl-4-(diethoxyphosphorylmethyl)phenol;(3,5-ditert-butyl-4-hydroxyphenyl)methyl-ethoxyphosphinate;methane |
| SMILES | C.CCOP(=O)(Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)OCC.CCOP(=O)([O-])Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H33O4P.C17H29O4P.CH4/c1-9-22-24(21,23-10-2)13-14-11-15(18(3,4)5)17(20)16(12-14)19(6,7)8;1-8-21-22(19,20)11-12-9-13(16(2,3)4)15(18)14(10-12)17(5,6)7;/h11-12,20H,9-10,13H2,1-8H3;9-10,18H,8,11H2,1-7H3,(H,19,20);1H4/p-1 |
| InChIKey | FOCZSYBZOLBXKK-UHFFFAOYSA-M |
| XLogP | 10.47 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.87 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|