C19H32O3 — CID 145003703
2,6-ditert-butyl-4-propylphenol;methyl formate (PubChem CID 145003703) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-propylphenol;methyl formate.
| Compound Name | 2,6-ditert-butyl-4-propylphenol;methyl formate |
|---|---|
| PubChem CID | 145003703 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | 2,6-ditert-butyl-4-propylphenol;methyl formate |
| SMILES | CCCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.COC=O |
| InChI | InChI=1S/C17H28O.C2H4O2/c1-8-9-12-10-13(16(2,3)4)15(18)14(11-12)17(5,6)7;1-4-2-3/h10-11,18H,8-9H2,1-7H3;2H,1H3 |
| InChIKey | LDSSUKPXJUDIPB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|