C27H41NO4 — CID 143450497
2,6-ditert-butyl-4-propylphenol;methyl 2-[4-(methylamino)phenoxy]acetate (PubChem CID 143450497) has the molecular formula C27H41NO4 and a molecular weight of 443.63 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-propylphenol;methyl 2-[4-(methylamino)phenoxy]acetate.
| Compound Name | 2,6-ditert-butyl-4-propylphenol;methyl 2-[4-(methylamino)phenoxy]acetate |
|---|---|
| PubChem CID | 143450497 |
| Molecular Formula | C27H41NO4 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.30 |
| IUPAC Name | 2,6-ditert-butyl-4-propylphenol;methyl 2-[4-(methylamino)phenoxy]acetate |
| SMILES | CCCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.CNc1ccc(OCC(=O)OC)cc1 |
| InChI | InChI=1S/C17H28O.C10H13NO3/c1-8-9-12-10-13(16(2,3)4)15(18)14(11-12)17(5,6)7;1-11-8-3-5-9(6-4-8)14-7-10(12)13-2/h10-11,18H,8-9H2,1-7H3;3-6,11H,7H2,1-2H3 |
| InChIKey | CKBRRDWJFWXNEB-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|