C17H30N2O2 — CID 158878074
3-(3,5-ditert-butyl-4-hydroxyphenyl)propanal;hydrazine (PubChem CID 158878074) has the molecular formula C17H30N2O2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanal;hydrazine.
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanal;hydrazine |
|---|---|
| PubChem CID | 158878074 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanal;hydrazine |
| SMILES | CC(C)(C)c1cc(CCC=O)cc(C(C)(C)C)c1O.NN |
| InChI | InChI=1S/C17H26O2.H4N2/c1-16(2,3)13-10-12(8-7-9-18)11-14(15(13)19)17(4,5)6;1-2/h9-11,19H,7-8H2,1-6H3;1-2H2 |
| InChIKey | JCRNIJRKGMXZFH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|