C21H33N3O3 — CID 143335527
3-(3-amino-5-tert-butyl-4-hydroxyphenyl)propanal;hexa-1,5-diene-3,4-diimine;methoxymethane (PubChem CID 143335527) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is 3-(3-amino-5-tert-butyl-4-hydroxyphenyl)propanal;hexa-1,5-diene-3,4-diimine;methoxymethane.
| Compound Name | 3-(3-amino-5-tert-butyl-4-hydroxyphenyl)propanal;hexa-1,5-diene-3,4-diimine;methoxymethane |
|---|---|
| PubChem CID | 143335527 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | 3-(3-amino-5-tert-butyl-4-hydroxyphenyl)propanal;hexa-1,5-diene-3,4-diimine;methoxymethane |
| SMILES | CC(C)(C)c1cc(CCC=O)cc(N)c1O.COC.[H]N=C(C=C)/C(C=C)=N/[H] |
| InChI | InChI=1S/C13H19NO2.C6H8N2.C2H6O/c1-13(2,3)10-7-9(5-4-6-15)8-11(14)12(10)16;1-3-5(7)6(8)4-2;1-3-2/h6-8,16H,4-5,14H2,1-3H3;3-4,7-8H,1-2H2;1-2H3/b;7-5+,8-6+; |
| InChIKey | CKJCDVLFVWSDBQ-UJPCKICKSA-N |
| XLogP | 4.06 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|