C15H18O2 — CID 88801025
3-[4-hydroxy-3,5-bis(prop-2-enyl)phenyl]propanal (PubChem CID 88801025) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-[4-hydroxy-3,5-bis(prop-2-enyl)phenyl]propanal.
| Compound Name | 3-[4-hydroxy-3,5-bis(prop-2-enyl)phenyl]propanal |
|---|---|
| PubChem CID | 88801025 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 3-[4-hydroxy-3,5-bis(prop-2-enyl)phenyl]propanal |
| SMILES | C=CCc1cc(CCC=O)cc(CC=C)c1O |
| InChI | InChI=1S/C15H18O2/c1-3-6-13-10-12(8-5-9-16)11-14(7-4-2)15(13)17/h3-4,9-11,17H,1-2,5-8H2 |
| InChIKey | PAGWTXLFZVLWGS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|