C13H19NO2 — CID 170868751
4-(2-aminoethyl)-2-ethoxy-6-prop-2-enylphenol (PubChem CID 170868751) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 4-(2-aminoethyl)-2-ethoxy-6-prop-2-enylphenol.
| Compound Name | 4-(2-aminoethyl)-2-ethoxy-6-prop-2-enylphenol |
|---|---|
| PubChem CID | 170868751 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 4-(2-aminoethyl)-2-ethoxy-6-prop-2-enylphenol |
| SMILES | C=CCc1cc(CCN)cc(OCC)c1O |
| InChI | InChI=1S/C13H19NO2/c1-3-5-11-8-10(6-7-14)9-12(13(11)15)16-4-2/h3,8-9,15H,1,4-7,14H2,2H3 |
| InChIKey | CZVFNAMBZWKCCW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|