C18H18BrNO2 — CID 137173615
4-[(2-bromophenyl)iminomethyl]-2-ethoxy-6-prop-2-enylphenol (PubChem CID 137173615) has the molecular formula C18H18BrNO2 and a molecular weight of 360.25 g/mol. Its IUPAC name is 4-[(2-bromophenyl)iminomethyl]-2-ethoxy-6-prop-2-enylphenol.
| Compound Name | 4-[(2-bromophenyl)iminomethyl]-2-ethoxy-6-prop-2-enylphenol |
|---|---|
| PubChem CID | 137173615 |
| Molecular Formula | C18H18BrNO2 |
| Molecular Weight | 360.25 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 4-[(2-bromophenyl)iminomethyl]-2-ethoxy-6-prop-2-enylphenol |
| SMILES | C=CCc1cc(/C=N/c2ccccc2Br)cc(OCC)c1O |
| InChI | InChI=1S/C18H18BrNO2/c1-3-7-14-10-13(11-17(18(14)21)22-4-2)12-20-16-9-6-5-8-15(16)19/h3,5-6,8-12,21H,1,4,7H2,2H3/b20-12+ |
| InChIKey | LZVJVDMXESFWLI-UDWIEESQSA-N |
| XLogP | 5.03 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.25 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|