C24H29NO2 — CID 137101752
4-[(4-cyclohexylphenyl)iminomethyl]-2-ethoxy-6-prop-2-enylphenol (PubChem CID 137101752) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is 4-[(4-cyclohexylphenyl)iminomethyl]-2-ethoxy-6-prop-2-enylphenol.
| Compound Name | 4-[(4-cyclohexylphenyl)iminomethyl]-2-ethoxy-6-prop-2-enylphenol |
|---|---|
| PubChem CID | 137101752 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 4-[(4-cyclohexylphenyl)iminomethyl]-2-ethoxy-6-prop-2-enylphenol |
| SMILES | C=CCc1cc(/C=N/c2ccc(C3CCCCC3)cc2)cc(OCC)c1O |
| InChI | InChI=1S/C24H29NO2/c1-3-8-21-15-18(16-23(24(21)26)27-4-2)17-25-22-13-11-20(12-14-22)19-9-6-5-7-10-19/h3,11-17,19,26H,1,4-10H2,2H3/b25-17+ |
| InChIKey | KPVUPDPUDOWJLS-KOEQRZSOSA-N |
| XLogP | 6.32 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|