C19H21NO3 — CID 137101758
2-ethoxy-4-[(3-methoxyphenyl)iminomethyl]-6-prop-2-enylphenol (PubChem CID 137101758) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is 2-ethoxy-4-[(3-methoxyphenyl)iminomethyl]-6-prop-2-enylphenol.
| Compound Name | 2-ethoxy-4-[(3-methoxyphenyl)iminomethyl]-6-prop-2-enylphenol |
|---|---|
| PubChem CID | 137101758 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 2-ethoxy-4-[(3-methoxyphenyl)iminomethyl]-6-prop-2-enylphenol |
| SMILES | C=CCc1cc(/C=N/c2cccc(OC)c2)cc(OCC)c1O |
| InChI | InChI=1S/C19H21NO3/c1-4-7-15-10-14(11-18(19(15)21)23-5-2)13-20-16-8-6-9-17(12-16)22-3/h4,6,8-13,21H,1,5,7H2,2-3H3/b20-13+ |
| InChIKey | URAZCMHTYKAWDF-DEDYPNTBSA-N |
| XLogP | 4.28 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|