C45H48O3 — CID 67817993
4-[[3,5-bis[[4-hydroxy-3,5-bis(prop-2-enyl)phenyl]methyl]phenyl]methyl]-2,6-bis(prop-2-enyl)phenol (PubChem CID 67817993) has the molecular formula C45H48O3 and a molecular weight of 636.88 g/mol. Its IUPAC name is 4-[[3,5-bis[[4-hydroxy-3,5-bis(prop-2-enyl)phenyl]methyl]phenyl]methyl]-2,6-bis(prop-2-enyl)phenol.
| Compound Name | 4-[[3,5-bis[[4-hydroxy-3,5-bis(prop-2-enyl)phenyl]methyl]phenyl]methyl]-2,6-bis(prop-2-enyl)phenol |
|---|---|
| PubChem CID | 67817993 |
| Molecular Formula | C45H48O3 |
| Molecular Weight | 636.88 g/mol |
| Exact Mass | 636.36 |
| IUPAC Name | 4-[[3,5-bis[[4-hydroxy-3,5-bis(prop-2-enyl)phenyl]methyl]phenyl]methyl]-2,6-bis(prop-2-enyl)phenol |
| SMILES | C=CCc1cc(Cc2cc(Cc3cc(CC=C)c(O)c(CC=C)c3)cc(Cc3cc(CC=C)c(O)c(CC=C)c3)c2)cc(CC=C)c1O |
| InChI | InChI=1S/C45H48O3/c1-7-13-37-25-34(26-38(14-8-2)43(37)46)22-31-19-32(23-35-27-39(15-9-3)44(47)40(28-35)16-10-4)21-33(20-31)24-36-29-41(17-11-5)45(48)42(30-36)18-12-6/h7-12,19-21,25-30,46-48H,1-6,13-18,22-24H2 |
| InChIKey | NTIYSNOWWDEDSC-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.88 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|