C13H15ClO — CID 70573204
4-(chloromethyl)-2,6-bis(prop-2-enyl)phenol (PubChem CID 70573204) has the molecular formula C13H15ClO and a molecular weight of 222.71 g/mol. Its IUPAC name is 4-(chloromethyl)-2,6-bis(prop-2-enyl)phenol.
| Compound Name | 4-(chloromethyl)-2,6-bis(prop-2-enyl)phenol |
|---|---|
| PubChem CID | 70573204 |
| Molecular Formula | C13H15ClO |
| Molecular Weight | 222.71 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 4-(chloromethyl)-2,6-bis(prop-2-enyl)phenol |
| SMILES | C=CCc1cc(CCl)cc(CC=C)c1O |
| InChI | InChI=1S/C13H15ClO/c1-3-5-11-7-10(9-14)8-12(6-4-2)13(11)15/h3-4,7-8,15H,1-2,5-6,9H2 |
| InChIKey | XPRQUHZALPNYDN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.71 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|