C15H22OS2 — CID 22065451
2,6-bis(ethylsulfanylmethyl)-4-prop-2-enylphenol (PubChem CID 22065451) has the molecular formula C15H22OS2 and a molecular weight of 282.47 g/mol. Its IUPAC name is 2,6-bis(ethylsulfanylmethyl)-4-prop-2-enylphenol.
| Compound Name | 2,6-bis(ethylsulfanylmethyl)-4-prop-2-enylphenol |
|---|---|
| PubChem CID | 22065451 |
| Molecular Formula | C15H22OS2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2,6-bis(ethylsulfanylmethyl)-4-prop-2-enylphenol |
| SMILES | C=CCc1cc(CSCC)c(O)c(CSCC)c1 |
| InChI | InChI=1S/C15H22OS2/c1-4-7-12-8-13(10-17-5-2)15(16)14(9-12)11-18-6-3/h4,8-9,16H,1,5-7,10-11H2,2-3H3 |
| InChIKey | IMFOOQOVMTUBAW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|