C21H34O — CID 19799403
2,6-dihexyl-4-prop-2-enylphenol (PubChem CID 19799403) has the molecular formula C21H34O and a molecular weight of 302.50 g/mol. Its IUPAC name is 2,6-dihexyl-4-prop-2-enylphenol.
| Compound Name | 2,6-dihexyl-4-prop-2-enylphenol |
|---|---|
| PubChem CID | 19799403 |
| Molecular Formula | C21H34O |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | 2,6-dihexyl-4-prop-2-enylphenol |
| SMILES | C=CCc1cc(CCCCCC)c(O)c(CCCCCC)c1 |
| InChI | InChI=1S/C21H34O/c1-4-7-9-11-14-19-16-18(13-6-3)17-20(21(19)22)15-12-10-8-5-2/h6,16-17,22H,3-5,7-15H2,1-2H3 |
| InChIKey | NLZDURYEDUPXKT-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|