C11H10FO3- — CID 19857313
2-(3-fluoro-4-hydroxy-5-prop-2-enylphenyl)acetate (PubChem CID 19857313) has the molecular formula C11H10FO3- and a molecular weight of 209.20 g/mol. Its IUPAC name is 2-(3-fluoro-4-hydroxy-5-prop-2-enylphenyl)acetate.
| Compound Name | 2-(3-fluoro-4-hydroxy-5-prop-2-enylphenyl)acetate |
|---|---|
| PubChem CID | 19857313 |
| Molecular Formula | C11H10FO3- |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 2-(3-fluoro-4-hydroxy-5-prop-2-enylphenyl)acetate |
| SMILES | C=CCc1cc(CC(=O)[O-])cc(F)c1O |
| InChI | InChI=1S/C11H11FO3/c1-2-3-8-4-7(6-10(13)14)5-9(12)11(8)15/h2,4-5,15H,1,3,6H2,(H,13,14)/p-1 |
| InChIKey | IVUDZINUNVMMAR-UHFFFAOYSA-M |
| XLogP | 0.55 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|