C15H18O — CID 20562879
2,4,5-tris(prop-2-enyl)phenol (PubChem CID 20562879) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is 2,4,5-tris(prop-2-enyl)phenol.
| Compound Name | 2,4,5-tris(prop-2-enyl)phenol |
|---|---|
| PubChem CID | 20562879 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 2,4,5-tris(prop-2-enyl)phenol |
| SMILES | C=CCc1cc(CC=C)c(CC=C)cc1O |
| InChI | InChI=1S/C15H18O/c1-4-7-12-10-14(9-6-3)15(16)11-13(12)8-5-2/h4-6,10-11,16H,1-3,7-9H2 |
| InChIKey | VUNMFQGLWUMKPY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|