C10H10O4 — CID 166062863
2-[2,5-dihydroxy-4-(2-oxoethyl)phenyl]acetaldehyde (PubChem CID 166062863) has the molecular formula C10H10O4 and a molecular weight of 194.19 g/mol. Its IUPAC name is 2-[2,5-dihydroxy-4-(2-oxoethyl)phenyl]acetaldehyde.
| Compound Name | 2-[2,5-dihydroxy-4-(2-oxoethyl)phenyl]acetaldehyde |
|---|---|
| PubChem CID | 166062863 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 2-[2,5-dihydroxy-4-(2-oxoethyl)phenyl]acetaldehyde |
| SMILES | O=CCc1cc(O)c(CC=O)cc1O |
| InChI | InChI=1S/C10H10O4/c11-3-1-7-5-10(14)8(2-4-12)6-9(7)13/h3-6,13-14H,1-2H2 |
| InChIKey | QOUINNQVOYTECI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|