C10H12O2 — CID 12635732
4-methyl-5-prop-2-enylbenzene-1,2-diol (PubChem CID 12635732) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 4-methyl-5-prop-2-enylbenzene-1,2-diol.
| Compound Name | 4-methyl-5-prop-2-enylbenzene-1,2-diol |
|---|---|
| PubChem CID | 12635732 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 4-methyl-5-prop-2-enylbenzene-1,2-diol |
| SMILES | C=CCc1cc(O)c(O)cc1C |
| InChI | InChI=1S/C10H12O2/c1-3-4-8-6-10(12)9(11)5-7(8)2/h3,5-6,11-12H,1,4H2,2H3 |
| InChIKey | OKAILJSRZHLPSS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|