C9H12O2 — CID 66591490
4-ethyl-5-methylbenzene-1,2-diol (PubChem CID 66591490) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 4-ethyl-5-methylbenzene-1,2-diol.
| Compound Name | 4-ethyl-5-methylbenzene-1,2-diol |
|---|---|
| PubChem CID | 66591490 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 4-ethyl-5-methylbenzene-1,2-diol |
| SMILES | CCc1cc(O)c(O)cc1C |
| InChI | InChI=1S/C9H12O2/c1-3-7-5-9(11)8(10)4-6(7)2/h4-5,10-11H,3H2,1-2H3 |
| InChIKey | QQAYDUPAKYYOFK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|