C10H12O3 — CID 15775117
4-methoxy-6-prop-2-enylbenzene-1,3-diol (PubChem CID 15775117) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 4-methoxy-6-prop-2-enylbenzene-1,3-diol.
| Compound Name | 4-methoxy-6-prop-2-enylbenzene-1,3-diol |
|---|---|
| PubChem CID | 15775117 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 4-methoxy-6-prop-2-enylbenzene-1,3-diol |
| SMILES | C=CCc1cc(OC)c(O)cc1O |
| InChI | InChI=1S/C10H12O3/c1-3-4-7-5-10(13-2)9(12)6-8(7)11/h3,5-6,11-12H,1,4H2,2H3 |
| InChIKey | RPEPCEMMUUSYSA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|