C27H42FN3O3 — CID 142988214
2-amino-6-tert-butyl-4-(2-fluoroethyl)phenol;cyclohexa-3,5-diene-1,2-diimine;octyl formate (PubChem CID 142988214) has the molecular formula C27H42FN3O3 and a molecular weight of 475.65 g/mol. Its IUPAC name is 2-amino-6-tert-butyl-4-(2-fluoroethyl)phenol;cyclohexa-3,5-diene-1,2-diimine;octyl formate.
| Compound Name | 2-amino-6-tert-butyl-4-(2-fluoroethyl)phenol;cyclohexa-3,5-diene-1,2-diimine;octyl formate |
|---|---|
| PubChem CID | 142988214 |
| Molecular Formula | C27H42FN3O3 |
| Molecular Weight | 475.65 g/mol |
| Exact Mass | 475.32 |
| IUPAC Name | 2-amino-6-tert-butyl-4-(2-fluoroethyl)phenol;cyclohexa-3,5-diene-1,2-diimine;octyl formate |
| SMILES | CC(C)(C)c1cc(CCF)cc(N)c1O.CCCCCCCCOC=O.[H]/N=C1\C=CC=C\C1=N/[H] |
| InChI | InChI=1S/C12H18FNO.C9H18O2.C6H6N2/c1-12(2,3)9-6-8(4-5-13)7-10(14)11(9)15;1-2-3-4-5-6-7-8-11-9-10;7-5-3-1-2-4-6(5)8/h6-7,15H,4-5,14H2,1-3H3;9H,2-8H2,1H3;1-4,7-8H/b;;7-5+,8-6+ |
| InChIKey | NEEINFDBQLBYGV-IKOFJTARSA-N |
| XLogP | 6.46 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.65 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|